C16H20N2O2 — CID 84641761
4-amino-6-propan-2-yl-2,3,4,9-tetrahydro-1H-carbazole-2-carboxylic acid (PubChem CID 84641761) has the molecular formula C16H20N2O2 and a molecular weight of 272.35 g/mol. Its IUPAC name is 4-amino-6-propan-2-yl-2,3,4,9-tetrahydro-1H-carbazole-2-carboxylic acid.
| Compound Name | 4-amino-6-propan-2-yl-2,3,4,9-tetrahydro-1H-carbazole-2-carboxylic acid |
|---|---|
| PubChem CID | 84641761 |
| Molecular Formula | C16H20N2O2 |
| Molecular Weight | 272.35 g/mol |
| Exact Mass | 272.15 |
| IUPAC Name | 4-amino-6-propan-2-yl-2,3,4,9-tetrahydro-1H-carbazole-2-carboxylic acid |
| SMILES | CC(C)c1ccc2[nH]c3c(c2c1)C(N)CC(C(=O)O)C3 |
| InChI | InChI=1S/C16H20N2O2/c1-8(2)9-3-4-13-11(5-9)15-12(17)6-10(16(19)20)7-14(15)18-13/h3-5,8,10,12,18H,6-7,17H2,1-2H3,(H,19,20) |
| InChIKey | KAHYHVHSIBXCEX-UHFFFAOYSA-N |
| XLogP | 2.94 |
| TPSA | 79.11 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.35 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|