C15H19N3 — CID 117355747
1-(9,11-diazatetracyclo[9.2.2.02,10.03,8]pentadeca-2(10),3(8),4,6-tetraen-5-yl)ethanamine (PubChem CID 117355747) has the molecular formula C15H19N3 and a molecular weight of 241.34 g/mol. Its IUPAC name is 1-(9,11-diazatetracyclo[9.2.2.02,10.03,8]pentadeca-2(10),3(8),4,6-tetraen-5-yl)ethanamine.
| Compound Name | 1-(9,11-diazatetracyclo[9.2.2.02,10.03,8]pentadeca-2(10),3(8),4,6-tetraen-5-yl)ethanamine |
|---|---|
| PubChem CID | 117355747 |
| Molecular Formula | C15H19N3 |
| Molecular Weight | 241.34 g/mol |
| Exact Mass | 241.16 |
| IUPAC Name | 1-(9,11-diazatetracyclo[9.2.2.02,10.03,8]pentadeca-2(10),3(8),4,6-tetraen-5-yl)ethanamine |
| SMILES | CC(N)c1ccc2[nH]c3c(c2c1)C1CCN3CC1 |
| InChI | InChI=1S/C15H19N3/c1-9(16)11-2-3-13-12(8-11)14-10-4-6-18(7-5-10)15(14)17-13/h2-3,8-10,17H,4-7,16H2,1H3 |
| InChIKey | CRBHWXFIKVOMAX-UHFFFAOYSA-N |
| XLogP | 2.88 |
| TPSA | 45.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 241.34 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |