C20H17ClF3N3O — CID 56552952
1-(8-chloro-1,3,4,5-tetrahydropyrido[4,3-b]indol-2-yl)-2-[3-(trifluoromethyl)anilino]ethanone (PubChem CID 56552952) has the molecular formula C20H17ClF3N3O and a molecular weight of 407.82 g/mol. Its IUPAC name is 1-(8-chloro-1,3,4,5-tetrahydropyrido[4,3-b]indol-2-yl)-2-[3-(trifluoromethyl)anilino]ethanone.
| Compound Name | 1-(8-chloro-1,3,4,5-tetrahydropyrido[4,3-b]indol-2-yl)-2-[3-(trifluoromethyl)anilino]ethanone |
|---|---|
| PubChem CID | 56552952 |
| Molecular Formula | C20H17ClF3N3O |
| Molecular Weight | 407.82 g/mol |
| Exact Mass | 407.10 |
| IUPAC Name | 1-(8-chloro-1,3,4,5-tetrahydropyrido[4,3-b]indol-2-yl)-2-[3-(trifluoromethyl)anilino]ethanone |
| SMILES | O=C(CNc1cccc(C(F)(F)F)c1)N1CCc2[nH]c3ccc(Cl)cc3c2C1 |
| InChI | InChI=1S/C20H17ClF3N3O/c21-13-4-5-17-15(9-13)16-11-27(7-6-18(16)26-17)19(28)10-25-14-3-1-2-12(8-14)20(22,23)24/h1-5,8-9,25-26H,6-7,10-11H2 |
| InChIKey | NYDBCSGHDOKTHE-UHFFFAOYSA-N |
| XLogP | 4.84 |
| TPSA | 48.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.82 |
| LogP ≤ 5 | 4.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|