C22H20ClF3N6O — CID 55931438
1-(8-chloro-1,3,4,5-tetrahydropyrido[4,3-b]indol-2-yl)-3-[5,7-dimethyl-2-(trifluoromethyl)-[1,2,4]triazolo[1,5-a]pyrimidin-6-yl]propan-1-one (PubChem CID 55931438) has the molecular formula C22H20ClF3N6O and a molecular weight of 476.89 g/mol. Its IUPAC name is 1-(8-chloro-1,3,4,5-tetrahydropyrido[4,3-b]indol-2-yl)-3-[5,7-dimethyl-2-(trifluoromethyl)-[1,2,4]triazolo[1,5-a]pyrimidin-6-yl]propan-1-one.
| Compound Name | 1-(8-chloro-1,3,4,5-tetrahydropyrido[4,3-b]indol-2-yl)-3-[5,7-dimethyl-2-(trifluoromethyl)-[1,2,4]triazolo[1,5-a]pyrimidin-6-yl]propan-1-one |
|---|---|
| PubChem CID | 55931438 |
| Molecular Formula | C22H20ClF3N6O |
| Molecular Weight | 476.89 g/mol |
| Exact Mass | 476.13 |
| IUPAC Name | 1-(8-chloro-1,3,4,5-tetrahydropyrido[4,3-b]indol-2-yl)-3-[5,7-dimethyl-2-(trifluoromethyl)-[1,2,4]triazolo[1,5-a]pyrimidin-6-yl]propan-1-one |
| SMILES | Cc1nc2nc(C(F)(F)F)nn2c(C)c1CCC(=O)N1CCc2[nH]c3ccc(Cl)cc3c2C1 |
| InChI | InChI=1S/C22H20ClF3N6O/c1-11-14(12(2)32-21(27-11)29-20(30-32)22(24,25)26)4-6-19(33)31-8-7-18-16(10-31)15-9-13(23)3-5-17(15)28-18/h3,5,9,28H,4,6-8,10H2,1-2H3 |
| InChIKey | NGYQDMWBDJGMNN-UHFFFAOYSA-N |
| XLogP | 4.41 |
| TPSA | 79.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.89 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|