C19H16F5N5O — CID 112833945
1-(4,6-difluoro-2,3-dihydroindol-1-yl)-3-[5,7-dimethyl-2-(trifluoromethyl)-[1,2,4]triazolo[1,5-a]pyrimidin-6-yl]propan-1-one (PubChem CID 112833945) has the molecular formula C19H16F5N5O and a molecular weight of 425.36 g/mol. Its IUPAC name is 1-(4,6-difluoro-2,3-dihydroindol-1-yl)-3-[5,7-dimethyl-2-(trifluoromethyl)-[1,2,4]triazolo[1,5-a]pyrimidin-6-yl]propan-1-one.
| Compound Name | 1-(4,6-difluoro-2,3-dihydroindol-1-yl)-3-[5,7-dimethyl-2-(trifluoromethyl)-[1,2,4]triazolo[1,5-a]pyrimidin-6-yl]propan-1-one |
|---|---|
| PubChem CID | 112833945 |
| Molecular Formula | C19H16F5N5O |
| Molecular Weight | 425.36 g/mol |
| Exact Mass | 425.13 |
| IUPAC Name | 1-(4,6-difluoro-2,3-dihydroindol-1-yl)-3-[5,7-dimethyl-2-(trifluoromethyl)-[1,2,4]triazolo[1,5-a]pyrimidin-6-yl]propan-1-one |
| SMILES | Cc1nc2nc(C(F)(F)F)nn2c(C)c1CCC(=O)N1CCc2c(F)cc(F)cc21 |
| InChI | InChI=1S/C19H16F5N5O/c1-9-12(10(2)29-18(25-9)26-17(27-29)19(22,23)24)3-4-16(30)28-6-5-13-14(21)7-11(20)8-15(13)28/h7-8H,3-6H2,1-2H3 |
| InChIKey | MZVAHKWLGRYOBK-UHFFFAOYSA-N |
| XLogP | 3.56 |
| TPSA | 63.39 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.36 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |