C21H19F6N5O — CID 46588645
3-[5,7-dimethyl-2-(trifluoromethyl)-[1,2,4]triazolo[1,5-a]pyrimidin-6-yl]-1-[6-(trifluoromethyl)-3,4-dihydro-2H-quinolin-1-yl]propan-1-one (PubChem CID 46588645) has the molecular formula C21H19F6N5O and a molecular weight of 471.41 g/mol. Its IUPAC name is 3-[5,7-dimethyl-2-(trifluoromethyl)-[1,2,4]triazolo[1,5-a]pyrimidin-6-yl]-1-[6-(trifluoromethyl)-3,4-dihydro-2H-quinolin-1-yl]propan-1-one.
| Compound Name | 3-[5,7-dimethyl-2-(trifluoromethyl)-[1,2,4]triazolo[1,5-a]pyrimidin-6-yl]-1-[6-(trifluoromethyl)-3,4-dihydro-2H-quinolin-1-yl]propan-1-one |
|---|---|
| PubChem CID | 46588645 |
| Molecular Formula | C21H19F6N5O |
| Molecular Weight | 471.41 g/mol |
| Exact Mass | 471.15 |
| IUPAC Name | 3-[5,7-dimethyl-2-(trifluoromethyl)-[1,2,4]triazolo[1,5-a]pyrimidin-6-yl]-1-[6-(trifluoromethyl)-3,4-dihydro-2H-quinolin-1-yl]propan-1-one |
| SMILES | Cc1nc2nc(C(F)(F)F)nn2c(C)c1CCC(=O)N1CCCc2cc(C(F)(F)F)ccc21 |
| InChI | InChI=1S/C21H19F6N5O/c1-11-15(12(2)32-19(28-11)29-18(30-32)21(25,26)27)6-8-17(33)31-9-3-4-13-10-14(20(22,23)24)5-7-16(13)31/h5,7,10H,3-4,6,8-9H2,1-2H3 |
| InChIKey | YCKMZRLNBKOFRN-UHFFFAOYSA-N |
| XLogP | 4.69 |
| TPSA | 63.39 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.41 |
| LogP ≤ 5 | 4.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |