C21H18ClN3O3 — CID 47066133
3-[3-(8-chloro-1,3,4,5-tetrahydropyrido[4,3-b]indol-2-yl)-3-oxopropyl]-1,3-benzoxazol-2-one (PubChem CID 47066133) has the molecular formula C21H18ClN3O3 and a molecular weight of 395.85 g/mol. Its IUPAC name is 3-[3-(8-chloro-1,3,4,5-tetrahydropyrido[4,3-b]indol-2-yl)-3-oxopropyl]-1,3-benzoxazol-2-one.
| Compound Name | 3-[3-(8-chloro-1,3,4,5-tetrahydropyrido[4,3-b]indol-2-yl)-3-oxopropyl]-1,3-benzoxazol-2-one |
|---|---|
| PubChem CID | 47066133 |
| Molecular Formula | C21H18ClN3O3 |
| Molecular Weight | 395.85 g/mol |
| Exact Mass | 395.10 |
| IUPAC Name | 3-[3-(8-chloro-1,3,4,5-tetrahydropyrido[4,3-b]indol-2-yl)-3-oxopropyl]-1,3-benzoxazol-2-one |
| SMILES | O=C(CCn1c(=O)oc2ccccc21)N1CCc2[nH]c3ccc(Cl)cc3c2C1 |
| InChI | InChI=1S/C21H18ClN3O3/c22-13-5-6-16-14(11-13)15-12-24(9-7-17(15)23-16)20(26)8-10-25-18-3-1-2-4-19(18)28-21(25)27/h1-6,11,23H,7-10,12H2 |
| InChIKey | TXTCGXJJUCZRFI-UHFFFAOYSA-N |
| XLogP | 3.70 |
| TPSA | 71.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.85 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|