C21H19Cl2N3O2S — CID 155532367
6-chloro-2-[6-chloro-4-(methoxymethoxymethyl)-1,3,4,9-tetrahydropyrido[3,4-b]indol-2-yl]-1,3-benzothiazole (PubChem CID 155532367) has the molecular formula C21H19Cl2N3O2S and a molecular weight of 448.38 g/mol. Its IUPAC name is 6-chloro-2-[6-chloro-4-(methoxymethoxymethyl)-1,3,4,9-tetrahydropyrido[3,4-b]indol-2-yl]-1,3-benzothiazole.
| Compound Name | 6-chloro-2-[6-chloro-4-(methoxymethoxymethyl)-1,3,4,9-tetrahydropyrido[3,4-b]indol-2-yl]-1,3-benzothiazole |
|---|---|
| PubChem CID | 155532367 |
| Molecular Formula | C21H19Cl2N3O2S |
| Molecular Weight | 448.38 g/mol |
| Exact Mass | 447.06 |
| IUPAC Name | 6-chloro-2-[6-chloro-4-(methoxymethoxymethyl)-1,3,4,9-tetrahydropyrido[3,4-b]indol-2-yl]-1,3-benzothiazole |
| SMILES | COCOCC1CN(c2nc3ccc(Cl)cc3s2)Cc2[nH]c3ccc(Cl)cc3c21 |
| InChI | InChI=1S/C21H19Cl2N3O2S/c1-27-11-28-10-12-8-26(21-25-17-5-3-14(23)7-19(17)29-21)9-18-20(12)15-6-13(22)2-4-16(15)24-18/h2-7,12,24H,8-11H2,1H3 |
| InChIKey | FGAFHQHHXNENHC-UHFFFAOYSA-N |
| XLogP | 5.81 |
| TPSA | 50.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.38 |
| LogP ≤ 5 | 5.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|