C23H26ClN5S — CID 156647564
[6-chloro-2-(6-methyl-1,3-benzothiazol-2-yl)-1,3,4,9-tetrahydropyrido[3,4-b]indol-4-yl]methylhydrazine;prop-1-ene (PubChem CID 156647564) has the molecular formula C23H26ClN5S and a molecular weight of 440.02 g/mol. Its IUPAC name is [6-chloro-2-(6-methyl-1,3-benzothiazol-2-yl)-1,3,4,9-tetrahydropyrido[3,4-b]indol-4-yl]methylhydrazine;prop-1-ene.
| Compound Name | [6-chloro-2-(6-methyl-1,3-benzothiazol-2-yl)-1,3,4,9-tetrahydropyrido[3,4-b]indol-4-yl]methylhydrazine;prop-1-ene |
|---|---|
| PubChem CID | 156647564 |
| Molecular Formula | C23H26ClN5S |
| Molecular Weight | 440.02 g/mol |
| Exact Mass | 439.16 |
| IUPAC Name | [6-chloro-2-(6-methyl-1,3-benzothiazol-2-yl)-1,3,4,9-tetrahydropyrido[3,4-b]indol-4-yl]methylhydrazine;prop-1-ene |
| SMILES | C=CC.Cc1ccc2nc(N3Cc4[nH]c5ccc(Cl)cc5c4C(CNN)C3)sc2c1 |
| InChI | InChI=1S/C20H20ClN5S.C3H6/c1-11-2-4-16-18(6-11)27-20(25-16)26-9-12(8-23-22)19-14-7-13(21)3-5-15(14)24-17(19)10-26;1-3-2/h2-7,12,23-24H,8-10,22H2,1H3;3H,1H2,2H3 |
| InChIKey | XBJZEJCLEZLLRQ-UHFFFAOYSA-N |
| XLogP | 5.50 |
| TPSA | 69.97 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.02 |
| LogP ≤ 5 | 5.50 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|