C27H28Cl2N4S2 — CID 156647567
4-[[6-chloro-2-(6-chloro-1,3-benzothiazol-2-yl)-1,3,4,9-tetrahydropyrido[3,4-b]indol-4-yl]methylsulfanyl]-N-ethenylbut-3-en-1-imine;ethane (PubChem CID 156647567) has the molecular formula C27H28Cl2N4S2 and a molecular weight of 543.59 g/mol. Its IUPAC name is 4-[[6-chloro-2-(6-chloro-1,3-benzothiazol-2-yl)-1,3,4,9-tetrahydropyrido[3,4-b]indol-4-yl]methylsulfanyl]-N-ethenylbut-3-en-1-imine;ethane.
| Compound Name | 4-[[6-chloro-2-(6-chloro-1,3-benzothiazol-2-yl)-1,3,4,9-tetrahydropyrido[3,4-b]indol-4-yl]methylsulfanyl]-N-ethenylbut-3-en-1-imine;ethane |
|---|---|
| PubChem CID | 156647567 |
| Molecular Formula | C27H28Cl2N4S2 |
| Molecular Weight | 543.59 g/mol |
| Exact Mass | 542.11 |
| IUPAC Name | 4-[[6-chloro-2-(6-chloro-1,3-benzothiazol-2-yl)-1,3,4,9-tetrahydropyrido[3,4-b]indol-4-yl]methylsulfanyl]-N-ethenylbut-3-en-1-imine;ethane |
| SMILES | C=C/N=C/CC=CSCC1CN(c2nc3ccc(Cl)cc3s2)Cc2[nH]c3ccc(Cl)cc3c21.CC |
| InChI | InChI=1S/C25H22Cl2N4S2.C2H6/c1-2-28-9-3-4-10-32-15-16-13-31(25-30-21-8-6-18(27)12-23(21)33-25)14-22-24(16)19-11-17(26)5-7-20(19)29-22;1-2/h2,4-12,16,29H,1,3,13-15H2;1-2H3/b10-4?,28-9+; |
| InChIKey | AORVDYNPJIQXEW-OMMQHIMLSA-N |
| XLogP | 9.07 |
| TPSA | 44.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 543.59 |
| LogP ≤ 5 | 9.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|