C22H19Cl2N3O2S — CID 156647566
propyl 6-chloro-2-(6-chloro-1,3-benzothiazol-2-yl)-1,3,4,9-tetrahydropyrido[3,4-b]indole-4-carboxylate (PubChem CID 156647566) has the molecular formula C22H19Cl2N3O2S and a molecular weight of 460.39 g/mol. Its IUPAC name is propyl 6-chloro-2-(6-chloro-1,3-benzothiazol-2-yl)-1,3,4,9-tetrahydropyrido[3,4-b]indole-4-carboxylate.
| Compound Name | propyl 6-chloro-2-(6-chloro-1,3-benzothiazol-2-yl)-1,3,4,9-tetrahydropyrido[3,4-b]indole-4-carboxylate |
|---|---|
| PubChem CID | 156647566 |
| Molecular Formula | C22H19Cl2N3O2S |
| Molecular Weight | 460.39 g/mol |
| Exact Mass | 459.06 |
| IUPAC Name | propyl 6-chloro-2-(6-chloro-1,3-benzothiazol-2-yl)-1,3,4,9-tetrahydropyrido[3,4-b]indole-4-carboxylate |
| SMILES | CCCOC(=O)C1CN(c2nc3ccc(Cl)cc3s2)Cc2[nH]c3ccc(Cl)cc3c21 |
| InChI | InChI=1S/C22H19Cl2N3O2S/c1-2-7-29-21(28)15-10-27(22-26-17-6-4-13(24)9-19(17)30-22)11-18-20(15)14-8-12(23)3-5-16(14)25-18/h3-6,8-9,15,25H,2,7,10-11H2,1H3 |
| InChIKey | CGHOCKHDHVCNJF-UHFFFAOYSA-N |
| XLogP | 6.14 |
| TPSA | 58.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.39 |
| LogP ≤ 5 | 6.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|