C21H18Cl2N4OS — CID 155519233
6-chloro-2-(6-chloro-1,3-benzothiazol-2-yl)-N,N-dimethyl-1,3,4,9-tetrahydropyrido[3,4-b]indole-4-carboxamide (PubChem CID 155519233) has the molecular formula C21H18Cl2N4OS and a molecular weight of 445.38 g/mol. Its IUPAC name is 6-chloro-2-(6-chloro-1,3-benzothiazol-2-yl)-N,N-dimethyl-1,3,4,9-tetrahydropyrido[3,4-b]indole-4-carboxamide.
| Compound Name | 6-chloro-2-(6-chloro-1,3-benzothiazol-2-yl)-N,N-dimethyl-1,3,4,9-tetrahydropyrido[3,4-b]indole-4-carboxamide |
|---|---|
| PubChem CID | 155519233 |
| Molecular Formula | C21H18Cl2N4OS |
| Molecular Weight | 445.38 g/mol |
| Exact Mass | 444.06 |
| IUPAC Name | 6-chloro-2-(6-chloro-1,3-benzothiazol-2-yl)-N,N-dimethyl-1,3,4,9-tetrahydropyrido[3,4-b]indole-4-carboxamide |
| SMILES | CN(C)C(=O)C1CN(c2nc3ccc(Cl)cc3s2)Cc2[nH]c3ccc(Cl)cc3c21 |
| InChI | InChI=1S/C21H18Cl2N4OS/c1-26(2)20(28)14-9-27(21-25-16-6-4-12(23)8-18(16)29-21)10-17-19(14)13-7-11(22)3-5-15(13)24-17/h3-8,14,24H,9-10H2,1-2H3 |
| InChIKey | VZFHMTAHMJEJBT-UHFFFAOYSA-N |
| XLogP | 5.28 |
| TPSA | 52.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.38 |
| LogP ≤ 5 | 5.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|