C13H14ClN3O2S — CID 166602787
4-(6-chloro-1,3-benzothiazol-2-yl)-N-methylmorpholine-2-carboxamide (PubChem CID 166602787) has the molecular formula C13H14ClN3O2S and a molecular weight of 311.79 g/mol. Its IUPAC name is 4-(6-chloro-1,3-benzothiazol-2-yl)-N-methylmorpholine-2-carboxamide.
| Compound Name | 4-(6-chloro-1,3-benzothiazol-2-yl)-N-methylmorpholine-2-carboxamide |
|---|---|
| PubChem CID | 166602787 |
| Molecular Formula | C13H14ClN3O2S |
| Molecular Weight | 311.79 g/mol |
| Exact Mass | 311.05 |
| IUPAC Name | 4-(6-chloro-1,3-benzothiazol-2-yl)-N-methylmorpholine-2-carboxamide |
| SMILES | CNC(=O)C1CN(c2nc3ccc(Cl)cc3s2)CCO1 |
| InChI | InChI=1S/C13H14ClN3O2S/c1-15-12(18)10-7-17(4-5-19-10)13-16-9-3-2-8(14)6-11(9)20-13/h2-3,6,10H,4-5,7H2,1H3,(H,15,18) |
| InChIKey | DNYKUVMXINNKFL-UHFFFAOYSA-N |
| XLogP | 1.90 |
| TPSA | 54.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.79 |
| LogP ≤ 5 | 1.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |