C19H15Cl2N3S2 — CID 156647547
[6-chloro-2-(6-chloro-1,3-benzothiazol-2-yl)-1,3,4,9-tetrahydropyrido[3,4-b]indol-4-yl]methanethiol (PubChem CID 156647547) has the molecular formula C19H15Cl2N3S2 and a molecular weight of 420.39 g/mol. Its IUPAC name is [6-chloro-2-(6-chloro-1,3-benzothiazol-2-yl)-1,3,4,9-tetrahydropyrido[3,4-b]indol-4-yl]methanethiol.
| Compound Name | [6-chloro-2-(6-chloro-1,3-benzothiazol-2-yl)-1,3,4,9-tetrahydropyrido[3,4-b]indol-4-yl]methanethiol |
|---|---|
| PubChem CID | 156647547 |
| Molecular Formula | C19H15Cl2N3S2 |
| Molecular Weight | 420.39 g/mol |
| Exact Mass | 419.01 |
| IUPAC Name | [6-chloro-2-(6-chloro-1,3-benzothiazol-2-yl)-1,3,4,9-tetrahydropyrido[3,4-b]indol-4-yl]methanethiol |
| SMILES | SCC1CN(c2nc3ccc(Cl)cc3s2)Cc2[nH]c3ccc(Cl)cc3c21 |
| InChI | InChI=1S/C19H15Cl2N3S2/c20-11-1-3-14-13(5-11)18-10(9-25)7-24(8-16(18)22-14)19-23-15-4-2-12(21)6-17(15)26-19/h1-6,10,22,25H,7-9H2 |
| InChIKey | OERGKIIRVSNAAA-UHFFFAOYSA-N |
| XLogP | 6.12 |
| TPSA | 31.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.39 |
| LogP ≤ 5 | 6.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|