C18H26N2O2S — CID 113089514
8-tert-butyl-2-propylsulfonyl-1,3,4,5-tetrahydropyrido[4,3-b]indole (PubChem CID 113089514) has the molecular formula C18H26N2O2S and a molecular weight of 334.49 g/mol. Its IUPAC name is 8-tert-butyl-2-propylsulfonyl-1,3,4,5-tetrahydropyrido[4,3-b]indole.
| Compound Name | 8-tert-butyl-2-propylsulfonyl-1,3,4,5-tetrahydropyrido[4,3-b]indole |
|---|---|
| PubChem CID | 113089514 |
| Molecular Formula | C18H26N2O2S |
| Molecular Weight | 334.49 g/mol |
| Exact Mass | 334.17 |
| IUPAC Name | 8-tert-butyl-2-propylsulfonyl-1,3,4,5-tetrahydropyrido[4,3-b]indole |
| SMILES | CCCS(=O)(=O)N1CCc2[nH]c3ccc(C(C)(C)C)cc3c2C1 |
| InChI | InChI=1S/C18H26N2O2S/c1-5-10-23(21,22)20-9-8-17-15(12-20)14-11-13(18(2,3)4)6-7-16(14)19-17/h6-7,11,19H,5,8-10,12H2,1-4H3 |
| InChIKey | FYLZMPYEHPEYMJ-UHFFFAOYSA-N |
| XLogP | 3.56 |
| TPSA | 53.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.49 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|