C15H17N3O4S — CID 110720855
5-(4-cyclopropyl-3-oxopiperazin-1-yl)sulfonyl-1,3-dihydroindol-2-one (PubChem CID 110720855) has the molecular formula C15H17N3O4S and a molecular weight of 335.39 g/mol. Its IUPAC name is 5-(4-cyclopropyl-3-oxopiperazin-1-yl)sulfonyl-1,3-dihydroindol-2-one.
| Compound Name | 5-(4-cyclopropyl-3-oxopiperazin-1-yl)sulfonyl-1,3-dihydroindol-2-one |
|---|---|
| PubChem CID | 110720855 |
| Molecular Formula | C15H17N3O4S |
| Molecular Weight | 335.39 g/mol |
| Exact Mass | 335.09 |
| IUPAC Name | 5-(4-cyclopropyl-3-oxopiperazin-1-yl)sulfonyl-1,3-dihydroindol-2-one |
| SMILES | O=C1Cc2cc(S(=O)(=O)N3CCN(C4CC4)C(=O)C3)ccc2N1 |
| InChI | InChI=1S/C15H17N3O4S/c19-14-8-10-7-12(3-4-13(10)16-14)23(21,22)17-5-6-18(11-1-2-11)15(20)9-17/h3-4,7,11H,1-2,5-6,8-9H2,(H,16,19) |
| InChIKey | KCVGUZDEXZPCNL-UHFFFAOYSA-N |
| XLogP | 0.18 |
| TPSA | 86.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.39 |
| LogP ≤ 5 | 0.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |