C19H20FN3O3S — CID 110293129
5-[3-(2-fluorophenyl)-4-methylpiperazin-1-yl]sulfonyl-1,3-dihydroindol-2-one (PubChem CID 110293129) has the molecular formula C19H20FN3O3S and a molecular weight of 389.45 g/mol. Its IUPAC name is 5-[3-(2-fluorophenyl)-4-methylpiperazin-1-yl]sulfonyl-1,3-dihydroindol-2-one.
| Compound Name | 5-[3-(2-fluorophenyl)-4-methylpiperazin-1-yl]sulfonyl-1,3-dihydroindol-2-one |
|---|---|
| PubChem CID | 110293129 |
| Molecular Formula | C19H20FN3O3S |
| Molecular Weight | 389.45 g/mol |
| Exact Mass | 389.12 |
| IUPAC Name | 5-[3-(2-fluorophenyl)-4-methylpiperazin-1-yl]sulfonyl-1,3-dihydroindol-2-one |
| SMILES | CN1CCN(S(=O)(=O)c2ccc3c(c2)CC(=O)N3)CC1c1ccccc1F |
| InChI | InChI=1S/C19H20FN3O3S/c1-22-8-9-23(12-18(22)15-4-2-3-5-16(15)20)27(25,26)14-6-7-17-13(10-14)11-19(24)21-17/h2-7,10,18H,8-9,11-12H2,1H3,(H,21,24) |
| InChIKey | ZFHHTKYUPYUADD-UHFFFAOYSA-N |
| XLogP | 2.00 |
| TPSA | 69.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.45 |
| LogP ≤ 5 | 2.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |