C18H17FN2O4S — CID 110326740
5-[2-(2-fluorophenyl)morpholin-4-yl]sulfonyl-1,3-dihydroindol-2-one (PubChem CID 110326740) has the molecular formula C18H17FN2O4S and a molecular weight of 376.41 g/mol. Its IUPAC name is 5-[2-(2-fluorophenyl)morpholin-4-yl]sulfonyl-1,3-dihydroindol-2-one.
| Compound Name | 5-[2-(2-fluorophenyl)morpholin-4-yl]sulfonyl-1,3-dihydroindol-2-one |
|---|---|
| PubChem CID | 110326740 |
| Molecular Formula | C18H17FN2O4S |
| Molecular Weight | 376.41 g/mol |
| Exact Mass | 376.09 |
| IUPAC Name | 5-[2-(2-fluorophenyl)morpholin-4-yl]sulfonyl-1,3-dihydroindol-2-one |
| SMILES | O=C1Cc2cc(S(=O)(=O)N3CCOC(c4ccccc4F)C3)ccc2N1 |
| InChI | InChI=1S/C18H17FN2O4S/c19-15-4-2-1-3-14(15)17-11-21(7-8-25-17)26(23,24)13-5-6-16-12(9-13)10-18(22)20-16/h1-6,9,17H,7-8,10-11H2,(H,20,22) |
| InChIKey | CDOAUWPVKKMKIY-UHFFFAOYSA-N |
| XLogP | 2.08 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.41 |
| LogP ≤ 5 | 2.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |