C17H25N3O3S — CID 113075154
5-(4-pentylpiperazin-1-yl)sulfonyl-1,3-dihydroindol-2-one (PubChem CID 113075154) has the molecular formula C17H25N3O3S and a molecular weight of 351.47 g/mol. Its IUPAC name is 5-(4-pentylpiperazin-1-yl)sulfonyl-1,3-dihydroindol-2-one.
| Compound Name | 5-(4-pentylpiperazin-1-yl)sulfonyl-1,3-dihydroindol-2-one |
|---|---|
| PubChem CID | 113075154 |
| Molecular Formula | C17H25N3O3S |
| Molecular Weight | 351.47 g/mol |
| Exact Mass | 351.16 |
| IUPAC Name | 5-(4-pentylpiperazin-1-yl)sulfonyl-1,3-dihydroindol-2-one |
| SMILES | CCCCCN1CCN(S(=O)(=O)c2ccc3c(c2)CC(=O)N3)CC1 |
| InChI | InChI=1S/C17H25N3O3S/c1-2-3-4-7-19-8-10-20(11-9-19)24(22,23)15-5-6-16-14(12-15)13-17(21)18-16/h5-6,12H,2-4,7-11,13H2,1H3,(H,18,21) |
| InChIKey | XEVUTFKDKAPOLI-UHFFFAOYSA-N |
| XLogP | 1.68 |
| TPSA | 69.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.47 |
| LogP ≤ 5 | 1.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|