C17H18N4O4S — CID 110805342
5-[4-(1H-pyrrole-2-carbonyl)piperazin-1-yl]sulfonyl-1,3-dihydroindol-2-one (PubChem CID 110805342) has the molecular formula C17H18N4O4S and a molecular weight of 374.42 g/mol. Its IUPAC name is 5-[4-(1H-pyrrole-2-carbonyl)piperazin-1-yl]sulfonyl-1,3-dihydroindol-2-one.
| Compound Name | 5-[4-(1H-pyrrole-2-carbonyl)piperazin-1-yl]sulfonyl-1,3-dihydroindol-2-one |
|---|---|
| PubChem CID | 110805342 |
| Molecular Formula | C17H18N4O4S |
| Molecular Weight | 374.42 g/mol |
| Exact Mass | 374.10 |
| IUPAC Name | 5-[4-(1H-pyrrole-2-carbonyl)piperazin-1-yl]sulfonyl-1,3-dihydroindol-2-one |
| SMILES | O=C1Cc2cc(S(=O)(=O)N3CCN(C(=O)c4ccc[nH]4)CC3)ccc2N1 |
| InChI | InChI=1S/C17H18N4O4S/c22-16-11-12-10-13(3-4-14(12)19-16)26(24,25)21-8-6-20(7-9-21)17(23)15-2-1-5-18-15/h1-5,10,18H,6-9,11H2,(H,19,22) |
| InChIKey | JDTASVOKYDSASR-UHFFFAOYSA-N |
| XLogP | 0.66 |
| TPSA | 102.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.42 |
| LogP ≤ 5 | 0.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |