C15H19N3O4S — CID 110809888
5-(4-methylsulfonyl-1,4-diazepane-1-carbonyl)-1,3-dihydroindol-2-one (PubChem CID 110809888) has the molecular formula C15H19N3O4S and a molecular weight of 337.40 g/mol. Its IUPAC name is 5-(4-methylsulfonyl-1,4-diazepane-1-carbonyl)-1,3-dihydroindol-2-one.
| Compound Name | 5-(4-methylsulfonyl-1,4-diazepane-1-carbonyl)-1,3-dihydroindol-2-one |
|---|---|
| PubChem CID | 110809888 |
| Molecular Formula | C15H19N3O4S |
| Molecular Weight | 337.40 g/mol |
| Exact Mass | 337.11 |
| IUPAC Name | 5-(4-methylsulfonyl-1,4-diazepane-1-carbonyl)-1,3-dihydroindol-2-one |
| SMILES | CS(=O)(=O)N1CCCN(C(=O)c2ccc3c(c2)CC(=O)N3)CC1 |
| InChI | InChI=1S/C15H19N3O4S/c1-23(21,22)18-6-2-5-17(7-8-18)15(20)11-3-4-13-12(9-11)10-14(19)16-13/h3-4,9H,2,5-8,10H2,1H3,(H,16,19) |
| InChIKey | SVJGMFLGYLXZRL-UHFFFAOYSA-N |
| XLogP | 0.29 |
| TPSA | 86.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.40 |
| LogP ≤ 5 | 0.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |