C15H19N3O5S — CID 110809923
6-(4-methylsulfonyl-1,4-diazepane-1-carbonyl)-4H-1,4-benzoxazin-3-one (PubChem CID 110809923) has the molecular formula C15H19N3O5S and a molecular weight of 353.40 g/mol. Its IUPAC name is 6-(4-methylsulfonyl-1,4-diazepane-1-carbonyl)-4H-1,4-benzoxazin-3-one.
| Compound Name | 6-(4-methylsulfonyl-1,4-diazepane-1-carbonyl)-4H-1,4-benzoxazin-3-one |
|---|---|
| PubChem CID | 110809923 |
| Molecular Formula | C15H19N3O5S |
| Molecular Weight | 353.40 g/mol |
| Exact Mass | 353.10 |
| IUPAC Name | 6-(4-methylsulfonyl-1,4-diazepane-1-carbonyl)-4H-1,4-benzoxazin-3-one |
| SMILES | CS(=O)(=O)N1CCCN(C(=O)c2ccc3c(c2)NC(=O)CO3)CC1 |
| InChI | InChI=1S/C15H19N3O5S/c1-24(21,22)18-6-2-5-17(7-8-18)15(20)11-3-4-13-12(9-11)16-14(19)10-23-13/h3-4,9H,2,5-8,10H2,1H3,(H,16,19) |
| InChIKey | RMVIJPNZPLEVBX-UHFFFAOYSA-N |
| XLogP | 0.12 |
| TPSA | 96.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.40 |
| LogP ≤ 5 | 0.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |