C19H25N3O4 — CID 110801782
6-[4-(2-ethylbutanoyl)piperazine-1-carbonyl]-4H-1,4-benzoxazin-3-one (PubChem CID 110801782) has the molecular formula C19H25N3O4 and a molecular weight of 359.43 g/mol. Its IUPAC name is 6-[4-(2-ethylbutanoyl)piperazine-1-carbonyl]-4H-1,4-benzoxazin-3-one.
| Compound Name | 6-[4-(2-ethylbutanoyl)piperazine-1-carbonyl]-4H-1,4-benzoxazin-3-one |
|---|---|
| PubChem CID | 110801782 |
| Molecular Formula | C19H25N3O4 |
| Molecular Weight | 359.43 g/mol |
| Exact Mass | 359.18 |
| IUPAC Name | 6-[4-(2-ethylbutanoyl)piperazine-1-carbonyl]-4H-1,4-benzoxazin-3-one |
| SMILES | CCC(CC)C(=O)N1CCN(C(=O)c2ccc3c(c2)NC(=O)CO3)CC1 |
| InChI | InChI=1S/C19H25N3O4/c1-3-13(4-2)18(24)21-7-9-22(10-8-21)19(25)14-5-6-16-15(11-14)20-17(23)12-26-16/h5-6,11,13H,3-4,7-10,12H2,1-2H3,(H,20,23) |
| InChIKey | PIRMXEQZGZTNLO-UHFFFAOYSA-N |
| XLogP | 1.74 |
| TPSA | 78.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.43 |
| LogP ≤ 5 | 1.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |