C14H14N2O4 — CID 96669404
6-(4-oxopiperidine-1-carbonyl)-4H-1,4-benzoxazin-3-one (PubChem CID 96669404) has the molecular formula C14H14N2O4 and a molecular weight of 274.28 g/mol. Its IUPAC name is 6-(4-oxopiperidine-1-carbonyl)-4H-1,4-benzoxazin-3-one.
| Compound Name | 6-(4-oxopiperidine-1-carbonyl)-4H-1,4-benzoxazin-3-one |
|---|---|
| PubChem CID | 96669404 |
| Molecular Formula | C14H14N2O4 |
| Molecular Weight | 274.28 g/mol |
| Exact Mass | 274.10 |
| IUPAC Name | 6-(4-oxopiperidine-1-carbonyl)-4H-1,4-benzoxazin-3-one |
| SMILES | O=C1CCN(C(=O)c2ccc3c(c2)NC(=O)CO3)CC1 |
| InChI | InChI=1S/C14H14N2O4/c17-10-3-5-16(6-4-10)14(19)9-1-2-12-11(7-9)15-13(18)8-20-12/h1-2,7H,3-6,8H2,(H,15,18) |
| InChIKey | TWYXTPSSAIEOPI-UHFFFAOYSA-N |
| XLogP | 0.82 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.28 |
| LogP ≤ 5 | 0.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |