C17H26N3O3S+ — CID 9264499
6-(4-butylpiperazin-4-ium-1-yl)sulfonyl-3,4-dihydro-1H-quinolin-2-one (PubChem CID 9264499) has the molecular formula C17H26N3O3S+ and a molecular weight of 352.48 g/mol. Its IUPAC name is 6-(4-butylpiperazin-4-ium-1-yl)sulfonyl-3,4-dihydro-1H-quinolin-2-one.
| Compound Name | 6-(4-butylpiperazin-4-ium-1-yl)sulfonyl-3,4-dihydro-1H-quinolin-2-one |
|---|---|
| PubChem CID | 9264499 |
| Molecular Formula | C17H26N3O3S+ |
| Molecular Weight | 352.48 g/mol |
| Exact Mass | 352.17 |
| IUPAC Name | 6-(4-butylpiperazin-4-ium-1-yl)sulfonyl-3,4-dihydro-1H-quinolin-2-one |
| SMILES | CCCC[NH+]1CCN(S(=O)(=O)c2ccc3c(c2)CCC(=O)N3)CC1 |
| InChI | InChI=1S/C17H25N3O3S/c1-2-3-8-19-9-11-20(12-10-19)24(22,23)15-5-6-16-14(13-15)4-7-17(21)18-16/h5-6,13H,2-4,7-12H2,1H3,(H,18,21)/p+1 |
| InChIKey | YDLNPHJWNBMKMD-UHFFFAOYSA-O |
| XLogP | 0.26 |
| TPSA | 70.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.48 |
| LogP ≤ 5 | 0.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |