C19H28N4O4S — CID 28533821
N-butyl-2-[4-[(2-oxo-3,4-dihydro-1H-quinolin-6-yl)sulfonyl]piperazin-1-yl]acetamide (PubChem CID 28533821) has the molecular formula C19H28N4O4S and a molecular weight of 408.52 g/mol. Its IUPAC name is N-butyl-2-[4-[(2-oxo-3,4-dihydro-1H-quinolin-6-yl)sulfonyl]piperazin-1-yl]acetamide.
| Compound Name | N-butyl-2-[4-[(2-oxo-3,4-dihydro-1H-quinolin-6-yl)sulfonyl]piperazin-1-yl]acetamide |
|---|---|
| PubChem CID | 28533821 |
| Molecular Formula | C19H28N4O4S |
| Molecular Weight | 408.52 g/mol |
| Exact Mass | 408.18 |
| IUPAC Name | N-butyl-2-[4-[(2-oxo-3,4-dihydro-1H-quinolin-6-yl)sulfonyl]piperazin-1-yl]acetamide |
| SMILES | CCCCNC(=O)CN1CCN(S(=O)(=O)c2ccc3c(c2)CCC(=O)N3)CC1 |
| InChI | InChI=1S/C19H28N4O4S/c1-2-3-8-20-19(25)14-22-9-11-23(12-10-22)28(26,27)16-5-6-17-15(13-16)4-7-18(24)21-17/h5-6,13H,2-4,7-12,14H2,1H3,(H,20,25)(H,21,24) |
| InChIKey | UABHAOREBAWIFS-UHFFFAOYSA-N |
| XLogP | 0.79 |
| TPSA | 98.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.52 |
| LogP ≤ 5 | 0.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|