C15H21Cl2N3O3S — CID 30171977
2-[4-(3,4-dichlorophenyl)sulfonylpiperazin-1-yl]-N-propylacetamide (PubChem CID 30171977) has the molecular formula C15H21Cl2N3O3S and a molecular weight of 394.32 g/mol. Its IUPAC name is 2-[4-(3,4-dichlorophenyl)sulfonylpiperazin-1-yl]-N-propylacetamide.
| Compound Name | 2-[4-(3,4-dichlorophenyl)sulfonylpiperazin-1-yl]-N-propylacetamide |
|---|---|
| PubChem CID | 30171977 |
| Molecular Formula | C15H21Cl2N3O3S |
| Molecular Weight | 394.32 g/mol |
| Exact Mass | 393.07 |
| IUPAC Name | 2-[4-(3,4-dichlorophenyl)sulfonylpiperazin-1-yl]-N-propylacetamide |
| SMILES | CCCNC(=O)CN1CCN(S(=O)(=O)c2ccc(Cl)c(Cl)c2)CC1 |
| InChI | InChI=1S/C15H21Cl2N3O3S/c1-2-5-18-15(21)11-19-6-8-20(9-7-19)24(22,23)12-3-4-13(16)14(17)10-12/h3-4,10H,2,5-9,11H2,1H3,(H,18,21) |
| InChIKey | WRJLTYUKKGFASG-UHFFFAOYSA-N |
| XLogP | 1.83 |
| TPSA | 69.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.32 |
| LogP ≤ 5 | 1.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |