C15H22ClN3O5S2 — CID 30872696
2-[4-(2-chloro-5-methylsulfonylphenyl)sulfonylpiperazin-1-yl]-N-ethylacetamide (PubChem CID 30872696) has the molecular formula C15H22ClN3O5S2 and a molecular weight of 423.94 g/mol. Its IUPAC name is 2-[4-(2-chloro-5-methylsulfonylphenyl)sulfonylpiperazin-1-yl]-N-ethylacetamide.
| Compound Name | 2-[4-(2-chloro-5-methylsulfonylphenyl)sulfonylpiperazin-1-yl]-N-ethylacetamide |
|---|---|
| PubChem CID | 30872696 |
| Molecular Formula | C15H22ClN3O5S2 |
| Molecular Weight | 423.94 g/mol |
| Exact Mass | 423.07 |
| IUPAC Name | 2-[4-(2-chloro-5-methylsulfonylphenyl)sulfonylpiperazin-1-yl]-N-ethylacetamide |
| SMILES | CCNC(=O)CN1CCN(S(=O)(=O)c2cc(S(C)(=O)=O)ccc2Cl)CC1 |
| InChI | InChI=1S/C15H22ClN3O5S2/c1-3-17-15(20)11-18-6-8-19(9-7-18)26(23,24)14-10-12(25(2,21)22)4-5-13(14)16/h4-5,10H,3,6-9,11H2,1-2H3,(H,17,20) |
| InChIKey | NBCJWOPEEYEPEV-UHFFFAOYSA-N |
| XLogP | 0.19 |
| TPSA | 103.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.94 |
| LogP ≤ 5 | 0.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |