C14H20FN3O5S2 — CID 166407090
3-[4-[2-(ethylamino)-2-oxoethyl]piperazin-1-yl]sulfonylbenzenesulfonyl fluoride (PubChem CID 166407090) has the molecular formula C14H20FN3O5S2 and a molecular weight of 393.46 g/mol. Its IUPAC name is 3-[4-[2-(ethylamino)-2-oxoethyl]piperazin-1-yl]sulfonylbenzenesulfonyl fluoride.
| Compound Name | 3-[4-[2-(ethylamino)-2-oxoethyl]piperazin-1-yl]sulfonylbenzenesulfonyl fluoride |
|---|---|
| PubChem CID | 166407090 |
| Molecular Formula | C14H20FN3O5S2 |
| Molecular Weight | 393.46 g/mol |
| Exact Mass | 393.08 |
| IUPAC Name | 3-[4-[2-(ethylamino)-2-oxoethyl]piperazin-1-yl]sulfonylbenzenesulfonyl fluoride |
| SMILES | CCNC(=O)CN1CCN(S(=O)(=O)c2cccc(S(=O)(=O)F)c2)CC1 |
| InChI | InChI=1S/C14H20FN3O5S2/c1-2-16-14(19)11-17-6-8-18(9-7-17)25(22,23)13-5-3-4-12(10-13)24(15,20)21/h3-5,10H,2,6-9,11H2,1H3,(H,16,19) |
| InChIKey | NALMJWVDMQLLNW-UHFFFAOYSA-N |
| XLogP | -0.21 |
| TPSA | 103.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.46 |
| LogP ≤ 5 | -0.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |