C14H19N3O3S — CID 110707877
5-(2,4-dimethylpiperazin-1-yl)sulfonyl-1,3-dihydroindol-2-one (PubChem CID 110707877) has the molecular formula C14H19N3O3S and a molecular weight of 309.39 g/mol. Its IUPAC name is 5-(2,4-dimethylpiperazin-1-yl)sulfonyl-1,3-dihydroindol-2-one.
| Compound Name | 5-(2,4-dimethylpiperazin-1-yl)sulfonyl-1,3-dihydroindol-2-one |
|---|---|
| PubChem CID | 110707877 |
| Molecular Formula | C14H19N3O3S |
| Molecular Weight | 309.39 g/mol |
| Exact Mass | 309.11 |
| IUPAC Name | 5-(2,4-dimethylpiperazin-1-yl)sulfonyl-1,3-dihydroindol-2-one |
| SMILES | CC1CN(C)CCN1S(=O)(=O)c1ccc2c(c1)CC(=O)N2 |
| InChI | InChI=1S/C14H19N3O3S/c1-10-9-16(2)5-6-17(10)21(19,20)12-3-4-13-11(7-12)8-14(18)15-13/h3-4,7,10H,5-6,8-9H2,1-2H3,(H,15,18) |
| InChIKey | ZLWTYEFRTIFUTL-UHFFFAOYSA-N |
| XLogP | 0.51 |
| TPSA | 69.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.39 |
| LogP ≤ 5 | 0.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |