C21H21FN2O2S — CID 113090132
6-fluoro-2-(5,6,7,8-tetrahydronaphthalen-2-ylsulfonyl)-1,3,4,9-tetrahydropyrido[3,4-b]indole (PubChem CID 113090132) has the molecular formula C21H21FN2O2S and a molecular weight of 384.48 g/mol. Its IUPAC name is 6-fluoro-2-(5,6,7,8-tetrahydronaphthalen-2-ylsulfonyl)-1,3,4,9-tetrahydropyrido[3,4-b]indole.
| Compound Name | 6-fluoro-2-(5,6,7,8-tetrahydronaphthalen-2-ylsulfonyl)-1,3,4,9-tetrahydropyrido[3,4-b]indole |
|---|---|
| PubChem CID | 113090132 |
| Molecular Formula | C21H21FN2O2S |
| Molecular Weight | 384.48 g/mol |
| Exact Mass | 384.13 |
| IUPAC Name | 6-fluoro-2-(5,6,7,8-tetrahydronaphthalen-2-ylsulfonyl)-1,3,4,9-tetrahydropyrido[3,4-b]indole |
| SMILES | O=S(=O)(c1ccc2c(c1)CCCC2)N1CCc2c([nH]c3ccc(F)cc23)C1 |
| InChI | InChI=1S/C21H21FN2O2S/c22-16-6-8-20-19(12-16)18-9-10-24(13-21(18)23-20)27(25,26)17-7-5-14-3-1-2-4-15(14)11-17/h5-8,11-12,23H,1-4,9-10,13H2 |
| InChIKey | KVSACEQEGBARGP-UHFFFAOYSA-N |
| XLogP | 3.93 |
| TPSA | 53.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.48 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|