C20H15BrN4O — CID 136919140
(3E)-5-bromo-3-[(Z)-2,3,4,9-tetrahydrocarbazol-1-ylidenehydrazinylidene]-1H-indol-2-one (PubChem CID 136919140) has the molecular formula C20H15BrN4O and a molecular weight of 407.27 g/mol. Its IUPAC name is (3E)-5-bromo-3-[(Z)-2,3,4,9-tetrahydrocarbazol-1-ylidenehydrazinylidene]-1H-indol-2-one.
| Compound Name | (3E)-5-bromo-3-[(Z)-2,3,4,9-tetrahydrocarbazol-1-ylidenehydrazinylidene]-1H-indol-2-one |
|---|---|
| PubChem CID | 136919140 |
| Molecular Formula | C20H15BrN4O |
| Molecular Weight | 407.27 g/mol |
| Exact Mass | 406.04 |
| IUPAC Name | (3E)-5-bromo-3-[(Z)-2,3,4,9-tetrahydrocarbazol-1-ylidenehydrazinylidene]-1H-indol-2-one |
| SMILES | O=C1Nc2ccc(Br)cc2/C1=N\N=C1\CCCc2c1[nH]c1ccccc21 |
| InChI | InChI=1S/C20H15BrN4O/c21-11-8-9-16-14(10-11)19(20(26)23-16)25-24-17-7-3-5-13-12-4-1-2-6-15(12)22-18(13)17/h1-2,4,6,8-10,22H,3,5,7H2,(H,23,25,26)/b24-17- |
| InChIKey | VDYQIVQTHLARIT-ULJHMMPZSA-N |
| XLogP | 4.41 |
| TPSA | 69.61 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.27 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'}, {'alert_name': 'imine_one_isatin(189)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|