C17H11BrN4O2S — CID 177407444
(2E)-2-[(Z)-(5-bromo-2-oxo-1H-indol-3-ylidene)hydrazinylidene]-3-phenyl-1,3-thiazolidin-4-one (PubChem CID 177407444) has the molecular formula C17H11BrN4O2S and a molecular weight of 415.27 g/mol. Its IUPAC name is (2E)-2-[(Z)-(5-bromo-2-oxo-1H-indol-3-ylidene)hydrazinylidene]-3-phenyl-1,3-thiazolidin-4-one.
| Compound Name | (2E)-2-[(Z)-(5-bromo-2-oxo-1H-indol-3-ylidene)hydrazinylidene]-3-phenyl-1,3-thiazolidin-4-one |
|---|---|
| PubChem CID | 177407444 |
| Molecular Formula | C17H11BrN4O2S |
| Molecular Weight | 415.27 g/mol |
| Exact Mass | 413.98 |
| IUPAC Name | (2E)-2-[(Z)-(5-bromo-2-oxo-1H-indol-3-ylidene)hydrazinylidene]-3-phenyl-1,3-thiazolidin-4-one |
| SMILES | O=C1Nc2ccc(Br)cc2/C1=N/N=C1/SCC(=O)N1c1ccccc1 |
| InChI | InChI=1S/C17H11BrN4O2S/c18-10-6-7-13-12(8-10)15(16(24)19-13)20-21-17-22(14(23)9-25-17)11-4-2-1-3-5-11/h1-8H,9H2,(H,19,20,24)/b21-17+ |
| InChIKey | CLCMSZVEZJZYSD-HEHNFIMWSA-N |
| XLogP | 3.24 |
| TPSA | 74.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.27 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_one_isatin(189)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|