C27H20BrFN4O2S — CID 175375354
2-[(5-bromo-2-oxo-1H-indol-3-ylidene)hydrazinylidene]-5-[(4-fluorophenyl)methylidene]-3-(3-propan-2-ylphenyl)-1,3-thiazolidin-4-one (PubChem CID 175375354) has the molecular formula C27H20BrFN4O2S and a molecular weight of 563.45 g/mol. Its IUPAC name is 2-[(5-bromo-2-oxo-1H-indol-3-ylidene)hydrazinylidene]-5-[(4-fluorophenyl)methylidene]-3-(3-propan-2-ylphenyl)-1,3-thiazolidin-4-one.
| Compound Name | 2-[(5-bromo-2-oxo-1H-indol-3-ylidene)hydrazinylidene]-5-[(4-fluorophenyl)methylidene]-3-(3-propan-2-ylphenyl)-1,3-thiazolidin-4-one |
|---|---|
| PubChem CID | 175375354 |
| Molecular Formula | C27H20BrFN4O2S |
| Molecular Weight | 563.45 g/mol |
| Exact Mass | 562.05 |
| IUPAC Name | 2-[(5-bromo-2-oxo-1H-indol-3-ylidene)hydrazinylidene]-5-[(4-fluorophenyl)methylidene]-3-(3-propan-2-ylphenyl)-1,3-thiazolidin-4-one |
| SMILES | CC(C)c1cccc(N2C(=O)C(=Cc3ccc(F)cc3)SC2=NN=C2C(=O)Nc3ccc(Br)cc32)c1 |
| InChI | InChI=1S/C27H20BrFN4O2S/c1-15(2)17-4-3-5-20(13-17)33-26(35)23(12-16-6-9-19(29)10-7-16)36-27(33)32-31-24-21-14-18(28)8-11-22(21)30-25(24)34/h3-15H,1-2H3,(H,30,31,34) |
| InChIKey | KATASZQSXFELPY-UHFFFAOYSA-N |
| XLogP | 6.54 |
| TPSA | 74.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 563.45 |
| LogP ≤ 5 | 6.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_one_isatin(189)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|