C26H18Br2N4O2S — CID 175252461
2-[(5-bromo-2-oxo-1H-indol-3-ylidene)hydrazinylidene]-5-[(3-bromophenyl)methylidene]-3-(2,6-dimethylphenyl)-1,3-thiazolidin-4-one (PubChem CID 175252461) has the molecular formula C26H18Br2N4O2S and a molecular weight of 610.33 g/mol. Its IUPAC name is 2-[(5-bromo-2-oxo-1H-indol-3-ylidene)hydrazinylidene]-5-[(3-bromophenyl)methylidene]-3-(2,6-dimethylphenyl)-1,3-thiazolidin-4-one.
| Compound Name | 2-[(5-bromo-2-oxo-1H-indol-3-ylidene)hydrazinylidene]-5-[(3-bromophenyl)methylidene]-3-(2,6-dimethylphenyl)-1,3-thiazolidin-4-one |
|---|---|
| PubChem CID | 175252461 |
| Molecular Formula | C26H18Br2N4O2S |
| Molecular Weight | 610.33 g/mol |
| Exact Mass | 607.95 |
| IUPAC Name | 2-[(5-bromo-2-oxo-1H-indol-3-ylidene)hydrazinylidene]-5-[(3-bromophenyl)methylidene]-3-(2,6-dimethylphenyl)-1,3-thiazolidin-4-one |
| SMILES | Cc1cccc(C)c1N1C(=O)C(=Cc2cccc(Br)c2)SC1=NN=C1C(=O)Nc2ccc(Br)cc21 |
| InChI | InChI=1S/C26H18Br2N4O2S/c1-14-5-3-6-15(2)23(14)32-25(34)21(12-16-7-4-8-17(27)11-16)35-26(32)31-30-22-19-13-18(28)9-10-20(19)29-24(22)33/h3-13H,1-2H3,(H,29,30,33) |
| InChIKey | MVIAREQNLYELET-UHFFFAOYSA-N |
| XLogP | 6.66 |
| TPSA | 74.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 610.33 |
| LogP ≤ 5 | 6.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_one_isatin(189)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|