C29H26N4O3S — CID 175269081
3-(4-tert-butylphenyl)-5-[(4-hydroxyphenyl)methylidene]-2-[(5-methyl-2-oxo-1H-indol-3-ylidene)hydrazinylidene]-1,3-thiazolidin-4-one (PubChem CID 175269081) has the molecular formula C29H26N4O3S and a molecular weight of 510.62 g/mol. Its IUPAC name is 3-(4-tert-butylphenyl)-5-[(4-hydroxyphenyl)methylidene]-2-[(5-methyl-2-oxo-1H-indol-3-ylidene)hydrazinylidene]-1,3-thiazolidin-4-one.
| Compound Name | 3-(4-tert-butylphenyl)-5-[(4-hydroxyphenyl)methylidene]-2-[(5-methyl-2-oxo-1H-indol-3-ylidene)hydrazinylidene]-1,3-thiazolidin-4-one |
|---|---|
| PubChem CID | 175269081 |
| Molecular Formula | C29H26N4O3S |
| Molecular Weight | 510.62 g/mol |
| Exact Mass | 510.17 |
| IUPAC Name | 3-(4-tert-butylphenyl)-5-[(4-hydroxyphenyl)methylidene]-2-[(5-methyl-2-oxo-1H-indol-3-ylidene)hydrazinylidene]-1,3-thiazolidin-4-one |
| SMILES | Cc1ccc2c(c1)C(=NN=C1SC(=Cc3ccc(O)cc3)C(=O)N1c1ccc(C(C)(C)C)cc1)C(=O)N2 |
| InChI | InChI=1S/C29H26N4O3S/c1-17-5-14-23-22(15-17)25(26(35)30-23)31-32-28-33(20-10-8-19(9-11-20)29(2,3)4)27(36)24(37-28)16-18-6-12-21(34)13-7-18/h5-16,34H,1-4H3,(H,30,31,35) |
| InChIKey | VQNNVYSKSIQDOE-UHFFFAOYSA-N |
| XLogP | 5.83 |
| TPSA | 94.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 510.62 |
| LogP ≤ 5 | 5.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_one_isatin(189)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|