C26H18F2N4O2S — CID 175252448
3-(2,4-dimethylphenyl)-2-[(5-fluoro-2-oxo-1H-indol-3-ylidene)hydrazinylidene]-5-[(4-fluorophenyl)methylidene]-1,3-thiazolidin-4-one (PubChem CID 175252448) has the molecular formula C26H18F2N4O2S and a molecular weight of 488.52 g/mol. Its IUPAC name is 3-(2,4-dimethylphenyl)-2-[(5-fluoro-2-oxo-1H-indol-3-ylidene)hydrazinylidene]-5-[(4-fluorophenyl)methylidene]-1,3-thiazolidin-4-one.
| Compound Name | 3-(2,4-dimethylphenyl)-2-[(5-fluoro-2-oxo-1H-indol-3-ylidene)hydrazinylidene]-5-[(4-fluorophenyl)methylidene]-1,3-thiazolidin-4-one |
|---|---|
| PubChem CID | 175252448 |
| Molecular Formula | C26H18F2N4O2S |
| Molecular Weight | 488.52 g/mol |
| Exact Mass | 488.11 |
| IUPAC Name | 3-(2,4-dimethylphenyl)-2-[(5-fluoro-2-oxo-1H-indol-3-ylidene)hydrazinylidene]-5-[(4-fluorophenyl)methylidene]-1,3-thiazolidin-4-one |
| SMILES | Cc1ccc(N2C(=O)C(=Cc3ccc(F)cc3)SC2=NN=C2C(=O)Nc3ccc(F)cc32)c(C)c1 |
| InChI | InChI=1S/C26H18F2N4O2S/c1-14-3-10-21(15(2)11-14)32-25(34)22(12-16-4-6-17(27)7-5-16)35-26(32)31-30-23-19-13-18(28)8-9-20(19)29-24(23)33/h3-13H,1-2H3,(H,29,30,33) |
| InChIKey | RMZFPWMSRLQKKW-UHFFFAOYSA-N |
| XLogP | 5.41 |
| TPSA | 74.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.52 |
| LogP ≤ 5 | 5.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_one_isatin(189)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|