C19H14N2OS2 — CID 122713961
4-[(Z)-[3-(2,4-dimethylphenyl)-4-oxo-2-sulfanylidene-1,3-thiazolidin-5-ylidene]methyl]benzonitrile (PubChem CID 122713961) has the molecular formula C19H14N2OS2 and a molecular weight of 350.47 g/mol. Its IUPAC name is 4-[(Z)-[3-(2,4-dimethylphenyl)-4-oxo-2-sulfanylidene-1,3-thiazolidin-5-ylidene]methyl]benzonitrile.
| Compound Name | 4-[(Z)-[3-(2,4-dimethylphenyl)-4-oxo-2-sulfanylidene-1,3-thiazolidin-5-ylidene]methyl]benzonitrile |
|---|---|
| PubChem CID | 122713961 |
| Molecular Formula | C19H14N2OS2 |
| Molecular Weight | 350.47 g/mol |
| Exact Mass | 350.05 |
| IUPAC Name | 4-[(Z)-[3-(2,4-dimethylphenyl)-4-oxo-2-sulfanylidene-1,3-thiazolidin-5-ylidene]methyl]benzonitrile |
| SMILES | Cc1ccc(N2C(=O)/C(=C/c3ccc(C#N)cc3)SC2=S)c(C)c1 |
| InChI | InChI=1S/C19H14N2OS2/c1-12-3-8-16(13(2)9-12)21-18(22)17(24-19(21)23)10-14-4-6-15(11-20)7-5-14/h3-10H,1-2H3/b17-10- |
| InChIKey | MVRPZGBXTZDOHT-YVLHZVERSA-N |
| XLogP | 4.58 |
| TPSA | 44.10 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.47 |
| LogP ≤ 5 | 4.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'ene_rhod_A(235)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|