C22H18N2O2S4 — CID 4762948
3-(2,4-dimethylphenyl)-5-[3-(2,4-dimethylphenyl)-4-oxo-2-sulfanylidene-1,3-thiazolidin-5-ylidene]-2-sulfanylidene-1,3-thiazolidin-4-one (PubChem CID 4762948) has the molecular formula C22H18N2O2S4 and a molecular weight of 470.67 g/mol. Its IUPAC name is 3-(2,4-dimethylphenyl)-5-[3-(2,4-dimethylphenyl)-4-oxo-2-sulfanylidene-1,3-thiazolidin-5-ylidene]-2-sulfanylidene-1,3-thiazolidin-4-one.
| Compound Name | 3-(2,4-dimethylphenyl)-5-[3-(2,4-dimethylphenyl)-4-oxo-2-sulfanylidene-1,3-thiazolidin-5-ylidene]-2-sulfanylidene-1,3-thiazolidin-4-one |
|---|---|
| PubChem CID | 4762948 |
| Molecular Formula | C22H18N2O2S4 |
| Molecular Weight | 470.67 g/mol |
| Exact Mass | 470.03 |
| IUPAC Name | 3-(2,4-dimethylphenyl)-5-[3-(2,4-dimethylphenyl)-4-oxo-2-sulfanylidene-1,3-thiazolidin-5-ylidene]-2-sulfanylidene-1,3-thiazolidin-4-one |
| SMILES | Cc1ccc(N2C(=O)C(=C3SC(=S)N(c4ccc(C)cc4C)C3=O)SC2=S)c(C)c1 |
| InChI | InChI=1S/C22H18N2O2S4/c1-11-5-7-15(13(3)9-11)23-19(25)17(29-21(23)27)18-20(26)24(22(28)30-18)16-8-6-12(2)10-14(16)4/h5-10H,1-4H3 |
| InChIKey | VRDUVEJKIDBJTN-UHFFFAOYSA-N |
| XLogP | 5.56 |
| TPSA | 40.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.67 |
| LogP ≤ 5 | 5.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'ene_rhod_A(235)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|