C24H25N3O2S2 — CID 4281915
5-[1-(diethylaminomethyl)-2-oxoindol-3-ylidene]-3-(2,4-dimethylphenyl)-2-sulfanylidene-1,3-thiazolidin-4-one (PubChem CID 4281915) has the molecular formula C24H25N3O2S2 and a molecular weight of 451.62 g/mol. Its IUPAC name is 5-[1-(diethylaminomethyl)-2-oxoindol-3-ylidene]-3-(2,4-dimethylphenyl)-2-sulfanylidene-1,3-thiazolidin-4-one.
| Compound Name | 5-[1-(diethylaminomethyl)-2-oxoindol-3-ylidene]-3-(2,4-dimethylphenyl)-2-sulfanylidene-1,3-thiazolidin-4-one |
|---|---|
| PubChem CID | 4281915 |
| Molecular Formula | C24H25N3O2S2 |
| Molecular Weight | 451.62 g/mol |
| Exact Mass | 451.14 |
| IUPAC Name | 5-[1-(diethylaminomethyl)-2-oxoindol-3-ylidene]-3-(2,4-dimethylphenyl)-2-sulfanylidene-1,3-thiazolidin-4-one |
| SMILES | CCN(CC)CN1C(=O)C(=C2SC(=S)N(c3ccc(C)cc3C)C2=O)c2ccccc21 |
| InChI | InChI=1S/C24H25N3O2S2/c1-5-25(6-2)14-26-19-10-8-7-9-17(19)20(22(26)28)21-23(29)27(24(30)31-21)18-12-11-15(3)13-16(18)4/h7-13H,5-6,14H2,1-4H3 |
| InChIKey | MRGGNBGUUJFCJE-UHFFFAOYSA-N |
| XLogP | 4.73 |
| TPSA | 43.86 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.62 |
| LogP ≤ 5 | 4.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'ene_rhod_A(235)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|