C17H9FN2OS2 — CID 75128933
4-[[3-(4-fluorophenyl)-4-oxo-2-sulfanylidene-1,3-thiazolidin-5-ylidene]methyl]benzonitrile (PubChem CID 75128933) has the molecular formula C17H9FN2OS2 and a molecular weight of 340.40 g/mol. Its IUPAC name is 4-[[3-(4-fluorophenyl)-4-oxo-2-sulfanylidene-1,3-thiazolidin-5-ylidene]methyl]benzonitrile.
| Compound Name | 4-[[3-(4-fluorophenyl)-4-oxo-2-sulfanylidene-1,3-thiazolidin-5-ylidene]methyl]benzonitrile |
|---|---|
| PubChem CID | 75128933 |
| Molecular Formula | C17H9FN2OS2 |
| Molecular Weight | 340.40 g/mol |
| Exact Mass | 340.01 |
| IUPAC Name | 4-[[3-(4-fluorophenyl)-4-oxo-2-sulfanylidene-1,3-thiazolidin-5-ylidene]methyl]benzonitrile |
| SMILES | N#Cc1ccc(C=C2SC(=S)N(c3ccc(F)cc3)C2=O)cc1 |
| InChI | InChI=1S/C17H9FN2OS2/c18-13-5-7-14(8-6-13)20-16(21)15(23-17(20)22)9-11-1-3-12(10-19)4-2-11/h1-9H |
| InChIKey | IFNKNTKZOPQHJX-UHFFFAOYSA-N |
| XLogP | 4.10 |
| TPSA | 44.10 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.40 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'ene_rhod_A(235)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|