C24H14BrFN4O3S — CID 175535811
3-(4-bromophenyl)-2-[(5-fluoro-2-oxo-1H-indol-3-ylidene)hydrazinylidene]-5-[(4-hydroxyphenyl)methylidene]-1,3-thiazolidin-4-one (PubChem CID 175535811) has the molecular formula C24H14BrFN4O3S and a molecular weight of 537.37 g/mol. Its IUPAC name is 3-(4-bromophenyl)-2-[(5-fluoro-2-oxo-1H-indol-3-ylidene)hydrazinylidene]-5-[(4-hydroxyphenyl)methylidene]-1,3-thiazolidin-4-one.
| Compound Name | 3-(4-bromophenyl)-2-[(5-fluoro-2-oxo-1H-indol-3-ylidene)hydrazinylidene]-5-[(4-hydroxyphenyl)methylidene]-1,3-thiazolidin-4-one |
|---|---|
| PubChem CID | 175535811 |
| Molecular Formula | C24H14BrFN4O3S |
| Molecular Weight | 537.37 g/mol |
| Exact Mass | 536.00 |
| IUPAC Name | 3-(4-bromophenyl)-2-[(5-fluoro-2-oxo-1H-indol-3-ylidene)hydrazinylidene]-5-[(4-hydroxyphenyl)methylidene]-1,3-thiazolidin-4-one |
| SMILES | O=C1Nc2ccc(F)cc2C1=NN=C1SC(=Cc2ccc(O)cc2)C(=O)N1c1ccc(Br)cc1 |
| InChI | InChI=1S/C24H14BrFN4O3S/c25-14-3-6-16(7-4-14)30-23(33)20(11-13-1-8-17(31)9-2-13)34-24(30)29-28-21-18-12-15(26)5-10-19(18)27-22(21)32/h1-12,31H,(H,27,28,32) |
| InChIKey | MZIUELUHTROXQW-UHFFFAOYSA-N |
| XLogP | 5.13 |
| TPSA | 94.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 537.37 |
| LogP ≤ 5 | 5.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_one_isatin(189)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|