C21H18BrN5OS2 — CID 135490447
(2Z)-3-(4-bromophenyl)-2-[(E)-1-(5-methyl-3-phenyl-2-sulfanylidene-1H-imidazol-4-yl)ethylidenehydrazinylidene]-1,3-thiazolidin-4-one (PubChem CID 135490447) has the molecular formula C21H18BrN5OS2 and a molecular weight of 500.45 g/mol. Its IUPAC name is (2Z)-3-(4-bromophenyl)-2-[(E)-1-(5-methyl-3-phenyl-2-sulfanylidene-1H-imidazol-4-yl)ethylidenehydrazinylidene]-1,3-thiazolidin-4-one.
| Compound Name | (2Z)-3-(4-bromophenyl)-2-[(E)-1-(5-methyl-3-phenyl-2-sulfanylidene-1H-imidazol-4-yl)ethylidenehydrazinylidene]-1,3-thiazolidin-4-one |
|---|---|
| PubChem CID | 135490447 |
| Molecular Formula | C21H18BrN5OS2 |
| Molecular Weight | 500.45 g/mol |
| Exact Mass | 499.01 |
| IUPAC Name | (2Z)-3-(4-bromophenyl)-2-[(E)-1-(5-methyl-3-phenyl-2-sulfanylidene-1H-imidazol-4-yl)ethylidenehydrazinylidene]-1,3-thiazolidin-4-one |
| SMILES | C/C(=N\N=C1/SCC(=O)N1c1ccc(Br)cc1)c1c(C)[nH]c(=S)n1-c1ccccc1 |
| InChI | InChI=1S/C21H18BrN5OS2/c1-13-19(27(20(29)23-13)16-6-4-3-5-7-16)14(2)24-25-21-26(18(28)12-30-21)17-10-8-15(22)9-11-17/h3-11H,12H2,1-2H3,(H,23,29)/b24-14+,25-21- |
| InChIKey | MMUNZMDVJOFDPN-HZCJYTJWSA-N |
| XLogP | 5.47 |
| TPSA | 65.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 500.45 |
| LogP ≤ 5 | 5.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|