C16H12N2O3S — CID 166643267
4-[(4-oxo-3-phenyl-1,3-thiazolidin-2-ylidene)amino]benzoic acid (PubChem CID 166643267) has the molecular formula C16H12N2O3S and a molecular weight of 312.35 g/mol. Its IUPAC name is 4-[(4-oxo-3-phenyl-1,3-thiazolidin-2-ylidene)amino]benzoic acid.
| Compound Name | 4-[(4-oxo-3-phenyl-1,3-thiazolidin-2-ylidene)amino]benzoic acid |
|---|---|
| PubChem CID | 166643267 |
| Molecular Formula | C16H12N2O3S |
| Molecular Weight | 312.35 g/mol |
| Exact Mass | 312.06 |
| IUPAC Name | 4-[(4-oxo-3-phenyl-1,3-thiazolidin-2-ylidene)amino]benzoic acid |
| SMILES | O=C(O)c1ccc(/N=C2\SCC(=O)N2c2ccccc2)cc1 |
| InChI | InChI=1S/C16H12N2O3S/c19-14-10-22-16(18(14)13-4-2-1-3-5-13)17-12-8-6-11(7-9-12)15(20)21/h1-9H,10H2,(H,20,21)/b17-16- |
| InChIKey | YKWSXIXBPNXJHB-MSUUIHNZSA-N |
| XLogP | 3.15 |
| TPSA | 69.97 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.35 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|