C22H16N4O5S2 — CID 6388539
4-[[(5Z)-5-[(4,6-dioxo-1-phenyl-2-sulfanylidene-1,3-diazinan-5-yl)methylidene]-3-methyl-4-oxo-1,3-thiazolidin-2-ylidene]amino]benzoic acid (PubChem CID 6388539) has the molecular formula C22H16N4O5S2 and a molecular weight of 480.53 g/mol. Its IUPAC name is 4-[[(5Z)-5-[(4,6-dioxo-1-phenyl-2-sulfanylidene-1,3-diazinan-5-yl)methylidene]-3-methyl-4-oxo-1,3-thiazolidin-2-ylidene]amino]benzoic acid.
| Compound Name | 4-[[(5Z)-5-[(4,6-dioxo-1-phenyl-2-sulfanylidene-1,3-diazinan-5-yl)methylidene]-3-methyl-4-oxo-1,3-thiazolidin-2-ylidene]amino]benzoic acid |
|---|---|
| PubChem CID | 6388539 |
| Molecular Formula | C22H16N4O5S2 |
| Molecular Weight | 480.53 g/mol |
| Exact Mass | 480.06 |
| IUPAC Name | 4-[[(5Z)-5-[(4,6-dioxo-1-phenyl-2-sulfanylidene-1,3-diazinan-5-yl)methylidene]-3-methyl-4-oxo-1,3-thiazolidin-2-ylidene]amino]benzoic acid |
| SMILES | CN1C(=O)/C(=C/C2C(=O)NC(=S)N(c3ccccc3)C2=O)S/C1=N/c1ccc(C(=O)O)cc1 |
| InChI | InChI=1S/C22H16N4O5S2/c1-25-19(29)16(33-22(25)23-13-9-7-12(8-10-13)20(30)31)11-15-17(27)24-21(32)26(18(15)28)14-5-3-2-4-6-14/h2-11,15H,1H3,(H,30,31)(H,24,27,32)/b16-11-,23-22+ |
| InChIKey | VDZURDTXTRYKDB-RVGPHNKXSA-N |
| XLogP | 2.53 |
| TPSA | 119.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.53 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|