C22H14BrN3O4S — CID 3066730
3-(2-benzoyl-4-nitrophenyl)-2-(4-bromophenyl)imino-1,3-thiazolidin-4-one (PubChem CID 3066730) has the molecular formula C22H14BrN3O4S and a molecular weight of 496.34 g/mol. Its IUPAC name is 3-(2-benzoyl-4-nitrophenyl)-2-(4-bromophenyl)imino-1,3-thiazolidin-4-one.
| Compound Name | 3-(2-benzoyl-4-nitrophenyl)-2-(4-bromophenyl)imino-1,3-thiazolidin-4-one |
|---|---|
| PubChem CID | 3066730 |
| Molecular Formula | C22H14BrN3O4S |
| Molecular Weight | 496.34 g/mol |
| Exact Mass | 494.99 |
| IUPAC Name | 3-(2-benzoyl-4-nitrophenyl)-2-(4-bromophenyl)imino-1,3-thiazolidin-4-one |
| SMILES | O=C(c1ccccc1)c1cc([N+](=O)[O-])ccc1N1C(=O)CS/C1=N\c1ccc(Br)cc1 |
| InChI | InChI=1S/C22H14BrN3O4S/c23-15-6-8-16(9-7-15)24-22-25(20(27)13-31-22)19-11-10-17(26(29)30)12-18(19)21(28)14-4-2-1-3-5-14/h1-12H,13H2/b24-22- |
| InChIKey | CNRWLJIUNRVMOJ-GYHWCHFESA-N |
| XLogP | 5.36 |
| TPSA | 92.88 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.34 |
| LogP ≤ 5 | 5.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|