C24H20N2OS — CID 11101054
7-(4-methylphenyl)imino-4,5-diphenyl-1,4-thiazepin-3-one (PubChem CID 11101054) has the molecular formula C24H20N2OS and a molecular weight of 384.50 g/mol. Its IUPAC name is 7-(4-methylphenyl)imino-4,5-diphenyl-1,4-thiazepin-3-one.
| Compound Name | 7-(4-methylphenyl)imino-4,5-diphenyl-1,4-thiazepin-3-one |
|---|---|
| PubChem CID | 11101054 |
| Molecular Formula | C24H20N2OS |
| Molecular Weight | 384.50 g/mol |
| Exact Mass | 384.13 |
| IUPAC Name | 7-(4-methylphenyl)imino-4,5-diphenyl-1,4-thiazepin-3-one |
| SMILES | Cc1ccc(/N=C2/C=C(c3ccccc3)N(c3ccccc3)C(=O)CS2)cc1 |
| InChI | InChI=1S/C24H20N2OS/c1-18-12-14-20(15-13-18)25-23-16-22(19-8-4-2-5-9-19)26(24(27)17-28-23)21-10-6-3-7-11-21/h2-16H,17H2,1H3/b25-23- |
| InChIKey | ORAASOMPTIDQQL-BZZOAKBMSA-N |
| XLogP | 5.85 |
| TPSA | 32.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.50 |
| LogP ≤ 5 | 5.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|