C32H24N2O2 — CID 10552238
3,6-bis(4-methylphenyl)-1,4-diphenylpyrrolo[3,2-b]pyrrole-2,5-dione (PubChem CID 10552238) has the molecular formula C32H24N2O2 and a molecular weight of 468.56 g/mol. Its IUPAC name is 3,6-bis(4-methylphenyl)-1,4-diphenylpyrrolo[3,2-b]pyrrole-2,5-dione.
| Compound Name | 3,6-bis(4-methylphenyl)-1,4-diphenylpyrrolo[3,2-b]pyrrole-2,5-dione |
|---|---|
| PubChem CID | 10552238 |
| Molecular Formula | C32H24N2O2 |
| Molecular Weight | 468.56 g/mol |
| Exact Mass | 468.18 |
| IUPAC Name | 3,6-bis(4-methylphenyl)-1,4-diphenylpyrrolo[3,2-b]pyrrole-2,5-dione |
| SMILES | Cc1ccc(C2=C3C(=C(c4ccc(C)cc4)C(=O)N3c3ccccc3)N(c3ccccc3)C2=O)cc1 |
| InChI | InChI=1S/C32H24N2O2/c1-21-13-17-23(18-14-21)27-29-30(34(31(27)35)26-11-7-4-8-12-26)28(24-19-15-22(2)16-20-24)32(36)33(29)25-9-5-3-6-10-25/h3-20H,1-2H3 |
| InChIKey | XSGYWVJODAHGSU-UHFFFAOYSA-N |
| XLogP | 6.52 |
| TPSA | 40.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.56 |
| LogP ≤ 5 | 6.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |