C34H28N2O2 — CID 15309240
3,6-dibenzyl-1,4-bis(4-methylphenyl)pyrrolo[3,2-b]pyrrole-2,5-dione (PubChem CID 15309240) has the molecular formula C34H28N2O2 and a molecular weight of 496.61 g/mol. Its IUPAC name is 3,6-dibenzyl-1,4-bis(4-methylphenyl)pyrrolo[3,2-b]pyrrole-2,5-dione.
| Compound Name | 3,6-dibenzyl-1,4-bis(4-methylphenyl)pyrrolo[3,2-b]pyrrole-2,5-dione |
|---|---|
| PubChem CID | 15309240 |
| Molecular Formula | C34H28N2O2 |
| Molecular Weight | 496.61 g/mol |
| Exact Mass | 496.22 |
| IUPAC Name | 3,6-dibenzyl-1,4-bis(4-methylphenyl)pyrrolo[3,2-b]pyrrole-2,5-dione |
| SMILES | Cc1ccc(N2C(=O)C(Cc3ccccc3)=C3C2=C(Cc2ccccc2)C(=O)N3c2ccc(C)cc2)cc1 |
| InChI | InChI=1S/C34H28N2O2/c1-23-13-17-27(18-14-23)35-31-29(21-25-9-5-3-6-10-25)34(38)36(28-19-15-24(2)16-20-28)32(31)30(33(35)37)22-26-11-7-4-8-12-26/h3-20H,21-22H2,1-2H3 |
| InChIKey | FAJBLZKGEKPGAL-UHFFFAOYSA-N |
| XLogP | 6.69 |
| TPSA | 40.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.61 |
| LogP ≤ 5 | 6.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |