C17H16N2O — CID 134873630
4-(dimethylamino)-1,3-diphenylazet-2-one (PubChem CID 134873630) has the molecular formula C17H16N2O and a molecular weight of 264.33 g/mol. Its IUPAC name is 4-(dimethylamino)-1,3-diphenylazet-2-one.
| Compound Name | 4-(dimethylamino)-1,3-diphenylazet-2-one |
|---|---|
| PubChem CID | 134873630 |
| Molecular Formula | C17H16N2O |
| Molecular Weight | 264.33 g/mol |
| Exact Mass | 264.13 |
| IUPAC Name | 4-(dimethylamino)-1,3-diphenylazet-2-one |
| SMILES | CN(C)C1=C(c2ccccc2)C(=O)N1c1ccccc1 |
| InChI | InChI=1S/C17H16N2O/c1-18(2)16-15(13-9-5-3-6-10-13)17(20)19(16)14-11-7-4-8-12-14/h3-12H,1-2H3 |
| InChIKey | PBSLEQRJAZXQQQ-UHFFFAOYSA-N |
| XLogP | 2.96 |
| TPSA | 23.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.33 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |